C22H31NO — CID 135018997
2-[(benzylamino)methyl]-4,6-ditert-butylphenol (PubChem CID 135018997) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is 2-[(benzylamino)methyl]-4,6-ditert-butylphenol.
| Compound Name | 2-[(benzylamino)methyl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 135018997 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 2-[(benzylamino)methyl]-4,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(CNCc2ccccc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H31NO/c1-21(2,3)18-12-17(20(24)19(13-18)22(4,5)6)15-23-14-16-10-8-7-9-11-16/h7-13,23-24H,14-15H2,1-6H3 |
| InChIKey | BPVKCLXZBIDMSQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|