C36H43NO2 — CID 27600404
2-[[benzyl-[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]methyl]-4,6-ditert-butylphenol (PubChem CID 27600404) has the molecular formula C36H43NO2 and a molecular weight of 521.75 g/mol. Its IUPAC name is 2-[[benzyl-[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]methyl]-4,6-ditert-butylphenol.
| Compound Name | 2-[[benzyl-[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]methyl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 27600404 |
| Molecular Formula | C36H43NO2 |
| Molecular Weight | 521.75 g/mol |
| Exact Mass | 521.33 |
| IUPAC Name | 2-[[benzyl-[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]methyl]-4,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(CN(Cc2ccccc2)[C@H](c2ccccc2)[C@@H](O)c2ccccc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H43NO2/c1-35(2,3)30-22-29(33(38)31(23-30)36(4,5)6)25-37(24-26-16-10-7-11-17-26)32(27-18-12-8-13-19-27)34(39)28-20-14-9-15-21-28/h7-23,32,34,38-39H,24-25H2,1-6H3/t32-,34+/m1/s1 |
| InChIKey | FRMFSZJHVBUNHA-CWTKIQHKSA-N |
| XLogP | 8.46 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.75 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|