C28H38N2O — CID 122226834
2,4-ditert-butyl-6-[[propan-2-yl(quinolin-2-ylmethyl)amino]methyl]phenol (PubChem CID 122226834) has the molecular formula C28H38N2O and a molecular weight of 418.63 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[propan-2-yl(quinolin-2-ylmethyl)amino]methyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[propan-2-yl(quinolin-2-ylmethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 122226834 |
| Molecular Formula | C28H38N2O |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.30 |
| IUPAC Name | 2,4-ditert-butyl-6-[[propan-2-yl(quinolin-2-ylmethyl)amino]methyl]phenol |
| SMILES | CC(C)N(Cc1ccc2ccccc2n1)Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C28H38N2O/c1-19(2)30(18-23-14-13-20-11-9-10-12-25(20)29-23)17-21-15-22(27(3,4)5)16-24(26(21)31)28(6,7)8/h9-16,19,31H,17-18H2,1-8H3 |
| InChIKey | AFWAUFUXWYVNLE-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|