C48H77NO4Zr — CID 5241995
2-[[bis[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]amino]methyl]-4,6-ditert-butylphenol;propan-2-ol;zirconium (PubChem CID 5241995) has the molecular formula C48H77NO4Zr and a molecular weight of 823.37 g/mol. Its IUPAC name is 2-[[bis[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]amino]methyl]-4,6-ditert-butylphenol;propan-2-ol;zirconium.
| Compound Name | 2-[[bis[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]amino]methyl]-4,6-ditert-butylphenol;propan-2-ol;zirconium |
|---|---|
| PubChem CID | 5241995 |
| Molecular Formula | C48H77NO4Zr |
| Molecular Weight | 823.37 g/mol |
| Exact Mass | 821.49 |
| IUPAC Name | 2-[[bis[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]amino]methyl]-4,6-ditert-butylphenol;propan-2-ol;zirconium |
| SMILES | CC(C)(C)c1cc(CN(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1.CC(C)O.[Zr] |
| InChI | InChI=1S/C45H69NO3.C3H8O.Zr/c1-40(2,3)31-19-28(37(47)34(22-31)43(10,11)12)25-46(26-29-20-32(41(4,5)6)23-35(38(29)48)44(13,14)15)27-30-21-33(42(7,8)9)24-36(39(30)49)45(16,17)18;1-3(2)4;/h19-24,47-49H,25-27H2,1-18H3;3-4H,1-2H3; |
| InChIKey | IIJCTDMWUGEJJJ-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.37 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|