C30H48FO4P — CID 87776014
2,4-ditert-butyl-6-[2-(3,5-ditert-butyl-2-hydroxyphenyl)ethyl]phenol;fluorophosphonous acid (PubChem CID 87776014) has the molecular formula C30H48FO4P and a molecular weight of 522.68 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[2-(3,5-ditert-butyl-2-hydroxyphenyl)ethyl]phenol;fluorophosphonous acid.
| Compound Name | 2,4-ditert-butyl-6-[2-(3,5-ditert-butyl-2-hydroxyphenyl)ethyl]phenol;fluorophosphonous acid |
|---|---|
| PubChem CID | 87776014 |
| Molecular Formula | C30H48FO4P |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | 2,4-ditert-butyl-6-[2-(3,5-ditert-butyl-2-hydroxyphenyl)ethyl]phenol;fluorophosphonous acid |
| SMILES | CC(C)(C)c1cc(CCc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1.OP(O)F |
| InChI | InChI=1S/C30H46O2.FH2O2P/c1-27(2,3)21-15-19(25(31)23(17-21)29(7,8)9)13-14-20-16-22(28(4,5)6)18-24(26(20)32)30(10,11)12;1-4(2)3/h15-18,31-32H,13-14H2,1-12H3;2-3H |
| InChIKey | RSVUAWCWMMDGAU-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|