C19H28O3 — CID 174910765
2-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]but-2-enoic acid (PubChem CID 174910765) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is 2-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]but-2-enoic acid.
| Compound Name | 2-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]but-2-enoic acid |
|---|---|
| PubChem CID | 174910765 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 2-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]but-2-enoic acid |
| SMILES | CC=C(Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1O)C(=O)O |
| InChI | InChI=1S/C19H28O3/c1-8-12(17(21)22)9-13-10-14(18(2,3)4)11-15(16(13)20)19(5,6)7/h8,10-11,20H,9H2,1-7H3,(H,21,22) |
| InChIKey | SMNIVXAPKWMCTC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|