C19H27NNa2O5 — CID 102146107
disodium;2-[carboxylatomethyl-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]amino]acetate (PubChem CID 102146107) has the molecular formula C19H27NNa2O5 and a molecular weight of 395.41 g/mol. Its IUPAC name is disodium;2-[carboxylatomethyl-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]amino]acetate.
| Compound Name | disodium;2-[carboxylatomethyl-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]amino]acetate |
|---|---|
| PubChem CID | 102146107 |
| Molecular Formula | C19H27NNa2O5 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | disodium;2-[carboxylatomethyl-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]amino]acetate |
| SMILES | CC(C)(C)c1cc(CN(CC(=O)[O-])CC(=O)[O-])c(O)c(C(C)(C)C)c1.[Na+].[Na+] |
| InChI | InChI=1S/C19H29NO5.2Na/c1-18(2,3)13-7-12(17(25)14(8-13)19(4,5)6)9-20(10-15(21)22)11-16(23)24;;/h7-8,25H,9-11H2,1-6H3,(H,21,22)(H,23,24);;/q;2*+1/p-2 |
| InChIKey | YTKFYFHQRYYUEJ-UHFFFAOYSA-L |
| XLogP | -5.70 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | -5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|