C35H61NO6Si — CID 139211955
2,4-ditert-butyl-6-[[(3,5-ditert-butyl-2-hydroxyphenyl)methyl-[3-[ethoxy(dihydroxy)silyl]propyl]amino]methyl]phenol;hydrate (PubChem CID 139211955) has the molecular formula C35H61NO6Si and a molecular weight of 619.96 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[(3,5-ditert-butyl-2-hydroxyphenyl)methyl-[3-[ethoxy(dihydroxy)silyl]propyl]amino]methyl]phenol;hydrate.
| Compound Name | 2,4-ditert-butyl-6-[[(3,5-ditert-butyl-2-hydroxyphenyl)methyl-[3-[ethoxy(dihydroxy)silyl]propyl]amino]methyl]phenol;hydrate |
|---|---|
| PubChem CID | 139211955 |
| Molecular Formula | C35H61NO6Si |
| Molecular Weight | 619.96 g/mol |
| Exact Mass | 619.43 |
| IUPAC Name | 2,4-ditert-butyl-6-[[(3,5-ditert-butyl-2-hydroxyphenyl)methyl-[3-[ethoxy(dihydroxy)silyl]propyl]amino]methyl]phenol;hydrate |
| SMILES | CCO[Si](O)(O)CCCN(Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1O)Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1O.O |
| InChI | InChI=1S/C35H59NO5Si.H2O/c1-14-41-42(39,40)17-15-16-36(22-24-18-26(32(2,3)4)20-28(30(24)37)34(8,9)10)23-25-19-27(33(5,6)7)21-29(31(25)38)35(11,12)13;/h18-21,37-40H,14-17,22-23H2,1-13H3;1H2 |
| InChIKey | IPZSMCGBRLDBGZ-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.96 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|