C33H52N4O4 — CID 139030894
1-N,3-N-bis[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]propanedihydrazide (PubChem CID 139030894) has the molecular formula C33H52N4O4 and a molecular weight of 568.80 g/mol. Its IUPAC name is 1-N,3-N-bis[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]propanedihydrazide.
| Compound Name | 1-N,3-N-bis[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]propanedihydrazide |
|---|---|
| PubChem CID | 139030894 |
| Molecular Formula | C33H52N4O4 |
| Molecular Weight | 568.80 g/mol |
| Exact Mass | 568.40 |
| IUPAC Name | 1-N,3-N-bis[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]propanedihydrazide |
| SMILES | CC(C)(C)c1cc(CN(N)C(=O)CC(=O)N(N)Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H52N4O4/c1-30(2,3)22-13-20(28(40)24(15-22)32(7,8)9)18-36(34)26(38)17-27(39)37(35)19-21-14-23(31(4,5)6)16-25(29(21)41)33(10,11)12/h13-16,40-41H,17-19,34-35H2,1-12H3 |
| InChIKey | SHPUKVYFYHRQQH-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 133.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.80 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|