C19H32N2O3S2 — CID 88806168
carbamothioic S-acid;O-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl] N,N-dimethylcarbamothioate (PubChem CID 88806168) has the molecular formula C19H32N2O3S2 and a molecular weight of 400.61 g/mol. Its IUPAC name is carbamothioic S-acid;O-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl] N,N-dimethylcarbamothioate.
| Compound Name | carbamothioic S-acid;O-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 88806168 |
| Molecular Formula | C19H32N2O3S2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | carbamothioic S-acid;O-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=S)OCc1cc(C(C)(C)C)cc(C(C)(C)C)c1O.NC(=O)S |
| InChI | InChI=1S/C18H29NO2S.CH3NOS/c1-17(2,3)13-9-12(11-21-16(22)19(7)8)15(20)14(10-13)18(4,5)6;2-1(3)4/h9-10,20H,11H2,1-8H3;(H3,2,3,4) |
| InChIKey | JTTZQDTVXFWEQU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|