C15H23NO2S — CID 88806201
O-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methyl] N,N-dimethylcarbamothioate (PubChem CID 88806201) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is O-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methyl] N,N-dimethylcarbamothioate.
| Compound Name | O-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 88806201 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | O-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methyl] N,N-dimethylcarbamothioate |
| SMILES | Cc1cc(COC(=S)N(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C15H23NO2S/c1-10-7-11(9-18-14(19)16(5)6)8-12(13(10)17)15(2,3)4/h7-8,17H,9H2,1-6H3 |
| InChIKey | SRKVNXDSTURAOE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|