C15H18O5-2 — CID 18414820
2-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methyl]propanedioate (PubChem CID 18414820) has the molecular formula C15H18O5-2 and a molecular weight of 278.30 g/mol. Its IUPAC name is 2-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methyl]propanedioate.
| Compound Name | 2-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 18414820 |
| Molecular Formula | C15H18O5-2 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-[(3-tert-butyl-4-hydroxy-5-methylphenyl)methyl]propanedioate |
| SMILES | Cc1cc(CC(C(=O)[O-])C(=O)[O-])cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C15H20O5/c1-8-5-9(6-10(13(17)18)14(19)20)7-11(12(8)16)15(2,3)4/h5,7,10,16H,6H2,1-4H3,(H,17,18)(H,19,20)/p-2 |
| InChIKey | AYHCRODGWSHDAZ-UHFFFAOYSA-L |
| XLogP | -0.34 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|