C20H34O3 — CID 20566819
3-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pentane-2,4-diol (PubChem CID 20566819) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pentane-2,4-diol.
| Compound Name | 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pentane-2,4-diol |
|---|---|
| PubChem CID | 20566819 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pentane-2,4-diol |
| SMILES | CC(O)C(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(C)O |
| InChI | InChI=1S/C20H34O3/c1-12(21)15(13(2)22)9-14-10-16(19(3,4)5)18(23)17(11-14)20(6,7)8/h10-13,15,21-23H,9H2,1-8H3 |
| InChIKey | KWGVCAYJFMAIFE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |