C18H24N2O — CID 21351406
2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedinitrile (PubChem CID 21351406) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedinitrile.
| Compound Name | 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedinitrile |
|---|---|
| PubChem CID | 21351406 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedinitrile |
| SMILES | CC(C)(C)c1cc(CC(C#N)C#N)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C18H24N2O/c1-17(2,3)14-8-12(7-13(10-19)11-20)9-15(16(14)21)18(4,5)6/h8-9,13,21H,7H2,1-6H3 |
| InChIKey | SSJFBOPXDKQBGH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |