C18H25NO — CID 143270223
2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]prop-2-enenitrile (PubChem CID 143270223) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]prop-2-enenitrile.
| Compound Name | 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 143270223 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]prop-2-enenitrile |
| SMILES | C=C(C#N)Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H25NO/c1-12(11-19)8-13-9-14(17(2,3)4)16(20)15(10-13)18(5,6)7/h9-10,20H,1,8H2,2-7H3 |
| InChIKey | OOIDJLSTADXXLH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|