C19H29O3- — CID 18542035
2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]prop-2-enoate;methane (PubChem CID 18542035) has the molecular formula C19H29O3- and a molecular weight of 305.44 g/mol. Its IUPAC name is 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]prop-2-enoate;methane.
| Compound Name | 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]prop-2-enoate;methane |
|---|---|
| PubChem CID | 18542035 |
| Molecular Formula | C19H29O3- |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]prop-2-enoate;methane |
| SMILES | C.C=C(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(=O)[O-] |
| InChI | InChI=1S/C18H26O3.CH4/c1-11(16(20)21)8-12-9-13(17(2,3)4)15(19)14(10-12)18(5,6)7;/h9-10,19H,1,8H2,2-7H3,(H,20,21);1H4/p-1 |
| InChIKey | DIQZGCCQHMIOLR-UHFFFAOYSA-M |
| XLogP | 3.47 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|