C54H75N3O9 — CID 57195252
1-[3,5-bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxopropanoyl]-1,3,5-triazinan-1-yl]-3-(3,5-ditert-butyl-4-hydroxyphenyl)propane-1,2-dione (PubChem CID 57195252) has the molecular formula C54H75N3O9 and a molecular weight of 910.21 g/mol. Its IUPAC name is 1-[3,5-bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxopropanoyl]-1,3,5-triazinan-1-yl]-3-(3,5-ditert-butyl-4-hydroxyphenyl)propane-1,2-dione.
| Compound Name | 1-[3,5-bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxopropanoyl]-1,3,5-triazinan-1-yl]-3-(3,5-ditert-butyl-4-hydroxyphenyl)propane-1,2-dione |
|---|---|
| PubChem CID | 57195252 |
| Molecular Formula | C54H75N3O9 |
| Molecular Weight | 910.21 g/mol |
| Exact Mass | 909.55 |
| IUPAC Name | 1-[3,5-bis[3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxopropanoyl]-1,3,5-triazinan-1-yl]-3-(3,5-ditert-butyl-4-hydroxyphenyl)propane-1,2-dione |
| SMILES | CC(C)(C)c1cc(CC(=O)C(=O)N2CN(C(=O)C(=O)Cc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)CN(C(=O)C(=O)Cc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)C2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C54H75N3O9/c1-49(2,3)34-19-31(20-35(43(34)61)50(4,5)6)25-40(58)46(64)55-28-56(47(65)41(59)26-32-21-36(51(7,8)9)44(62)37(22-32)52(10,11)12)30-57(29-55)48(66)42(60)27-33-23-38(53(13,14)15)45(63)39(24-33)54(16,17)18/h19-24,61-63H,25-30H2,1-18H3 |
| InChIKey | HRVOAYOKZRAQQJ-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 172.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.21 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|