C18H26O3 — CID 57227940
1-(3,5-ditert-butyl-4-hydroxyphenyl)butane-2,3-dione (PubChem CID 57227940) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-hydroxyphenyl)butane-2,3-dione.
| Compound Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)butane-2,3-dione |
|---|---|
| PubChem CID | 57227940 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)butane-2,3-dione |
| SMILES | CC(=O)C(=O)Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H26O3/c1-11(19)15(20)10-12-8-13(17(2,3)4)16(21)14(9-12)18(5,6)7/h8-9,21H,10H2,1-7H3 |
| InChIKey | RUNNLBNOBZTCCH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|