C30H46CuO8P2-4 — CID 157482776
copper;bis(2,6-ditert-butyl-4-(phosphonatomethyl)phenol) (PubChem CID 157482776) has the molecular formula C30H46CuO8P2-4 and a molecular weight of 660.18 g/mol. Its IUPAC name is copper;bis(2,6-ditert-butyl-4-(phosphonatomethyl)phenol).
| Compound Name | copper;bis(2,6-ditert-butyl-4-(phosphonatomethyl)phenol) |
|---|---|
| PubChem CID | 157482776 |
| Molecular Formula | C30H46CuO8P2-4 |
| Molecular Weight | 660.18 g/mol |
| Exact Mass | 659.20 |
| IUPAC Name | copper;bis(2,6-ditert-butyl-4-(phosphonatomethyl)phenol) |
| SMILES | CC(C)(C)c1cc(CP(=O)([O-])[O-])cc(C(C)(C)C)c1O.CC(C)(C)c1cc(CP(=O)([O-])[O-])cc(C(C)(C)C)c1O.[Cu] |
| InChI | InChI=1S/2C15H25O4P.Cu/c2*1-14(2,3)11-7-10(9-20(17,18)19)8-12(13(11)16)15(4,5)6;/h2*7-8,16H,9H2,1-6H3,(H2,17,18,19);/p-4 |
| InChIKey | UOWZLXIYVZTSDZ-UHFFFAOYSA-J |
| XLogP | 4.80 |
| TPSA | 166.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.18 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|