C30H47O5P — CID 149251641
(3,5-ditert-butyl-4-hydroxyphenyl)methoxy-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phosphinic acid (PubChem CID 149251641) has the molecular formula C30H47O5P and a molecular weight of 518.68 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxyphenyl)methoxy-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phosphinic acid.
| Compound Name | (3,5-ditert-butyl-4-hydroxyphenyl)methoxy-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phosphinic acid |
|---|---|
| PubChem CID | 149251641 |
| Molecular Formula | C30H47O5P |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.32 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxyphenyl)methoxy-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phosphinic acid |
| SMILES | CC(C)(C)c1cc(COP(=O)(O)Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C30H47O5P/c1-27(2,3)21-13-19(14-22(25(21)31)28(4,5)6)17-35-36(33,34)18-20-15-23(29(7,8)9)26(32)24(16-20)30(10,11)12/h13-16,31-32H,17-18H2,1-12H3,(H,33,34) |
| InChIKey | NBXHXWIQWFGMQE-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|