C17H30NiO6P- — CID 158833007
(3,5-ditert-butyl-4-hydroxyphenyl)methyl dihydrogen phosphate;ethanolate;nickel (PubChem CID 158833007) has the molecular formula C17H30NiO6P- and a molecular weight of 420.09 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxyphenyl)methyl dihydrogen phosphate;ethanolate;nickel.
| Compound Name | (3,5-ditert-butyl-4-hydroxyphenyl)methyl dihydrogen phosphate;ethanolate;nickel |
|---|---|
| PubChem CID | 158833007 |
| Molecular Formula | C17H30NiO6P- |
| Molecular Weight | 420.09 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxyphenyl)methyl dihydrogen phosphate;ethanolate;nickel |
| SMILES | CC(C)(C)c1cc(COP(=O)(O)O)cc(C(C)(C)C)c1O.CC[O-].[Ni] |
| InChI | InChI=1S/C15H25O5P.C2H5O.Ni/c1-14(2,3)11-7-10(9-20-21(17,18)19)8-12(13(11)16)15(4,5)6;1-2-3;/h7-8,16H,9H2,1-6H3,(H2,17,18,19);2H2,1H3;/q;-1; |
| InChIKey | SZHLMZRKPUPBJW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.09 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|