C33H48O6 — CID 54266161
bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl] propanedioate (PubChem CID 54266161) has the molecular formula C33H48O6 and a molecular weight of 540.74 g/mol. Its IUPAC name is bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl] propanedioate.
| Compound Name | bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl] propanedioate |
|---|---|
| PubChem CID | 54266161 |
| Molecular Formula | C33H48O6 |
| Molecular Weight | 540.74 g/mol |
| Exact Mass | 540.35 |
| IUPAC Name | bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl] propanedioate |
| SMILES | CC(C)(C)c1cc(COC(=O)CC(=O)OCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C33H48O6/c1-30(2,3)22-13-20(14-23(28(22)36)31(4,5)6)18-38-26(34)17-27(35)39-19-21-15-24(32(7,8)9)29(37)25(16-21)33(10,11)12/h13-16,36-37H,17-19H2,1-12H3 |
| InChIKey | RGXLNXLXPIBXNC-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.74 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|