C15H28O7P2 — CID 159405265
(3,5-ditert-butyl-4-hydroxyphenyl)methyl dihydrogen phosphite;phosphorous acid (PubChem CID 159405265) has the molecular formula C15H28O7P2 and a molecular weight of 382.33 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxyphenyl)methyl dihydrogen phosphite;phosphorous acid.
| Compound Name | (3,5-ditert-butyl-4-hydroxyphenyl)methyl dihydrogen phosphite;phosphorous acid |
|---|---|
| PubChem CID | 159405265 |
| Molecular Formula | C15H28O7P2 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxyphenyl)methyl dihydrogen phosphite;phosphorous acid |
| SMILES | CC(C)(C)c1cc(COP(O)O)cc(C(C)(C)C)c1O.OP(O)O |
| InChI | InChI=1S/C15H25O4P.H3O3P/c1-14(2,3)11-7-10(9-19-20(17)18)8-12(13(11)16)15(4,5)6;1-4(2)3/h7-8,16-18H,9H2,1-6H3;1-3H |
| InChIKey | LNWJJOAEMAZDER-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|