C17H26O2S — CID 87143193
O-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl] ethanethioate (PubChem CID 87143193) has the molecular formula C17H26O2S and a molecular weight of 294.46 g/mol. Its IUPAC name is O-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl] ethanethioate.
| Compound Name | O-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl] ethanethioate |
|---|---|
| PubChem CID | 87143193 |
| Molecular Formula | C17H26O2S |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | O-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl] ethanethioate |
| SMILES | CC(=S)OCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H26O2S/c1-11(20)19-10-12-8-13(16(2,3)4)15(18)14(9-12)17(5,6)7/h8-9,18H,10H2,1-7H3 |
| InChIKey | XHIOPDSTZZIFPS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|