C23H30O4 — CID 59265270
(3,5-ditert-butyl-4-hydroxyphenyl)methyl 2-(4-hydroxyphenyl)acetate (PubChem CID 59265270) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxyphenyl)methyl 2-(4-hydroxyphenyl)acetate.
| Compound Name | (3,5-ditert-butyl-4-hydroxyphenyl)methyl 2-(4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 59265270 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxyphenyl)methyl 2-(4-hydroxyphenyl)acetate |
| SMILES | CC(C)(C)c1cc(COC(=O)Cc2ccc(O)cc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H30O4/c1-22(2,3)18-11-16(12-19(21(18)26)23(4,5)6)14-27-20(25)13-15-7-9-17(24)10-8-15/h7-12,24,26H,13-14H2,1-6H3 |
| InChIKey | XTZDGIHQFQIQEH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |