C20H32O4 — CID 87837338
butyl (3,5-ditert-butyl-4-hydroxyphenyl)methyl carbonate (PubChem CID 87837338) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is butyl (3,5-ditert-butyl-4-hydroxyphenyl)methyl carbonate.
| Compound Name | butyl (3,5-ditert-butyl-4-hydroxyphenyl)methyl carbonate |
|---|---|
| PubChem CID | 87837338 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | butyl (3,5-ditert-butyl-4-hydroxyphenyl)methyl carbonate |
| SMILES | CCCCOC(=O)OCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H32O4/c1-8-9-10-23-18(22)24-13-14-11-15(19(2,3)4)17(21)16(12-14)20(5,6)7/h11-12,21H,8-10,13H2,1-7H3 |
| InChIKey | OEELBCPYIKKION-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|