butyl (3,5-ditert-butyl-4-hydroxyphenyl)methyl carbonate

C20H32O4 — CID 87837338

IUPACbutyl (3,5-ditert-butyl-4-hydroxyphenyl)methyl carbonate
SMILESCCCCOC(=O)OCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1
InChIInChI=1S/C20H32O4/c1-8-9-10-23-18(22)24-13-14-11-15(19(2,3)4)17(21)16(12-14)20(5,6)7/h11-12,21H,8-10,13H2,1-7H3
InChIKeyOEELBCPYIKKION-UHFFFAOYSA-N
MW336.47 g/mol
LogP5.44
Rot. Bonds5

About butyl (3,5-ditert-butyl-4-hydroxyphenyl)methyl carbonate

butyl (3,5-ditert-butyl-4-hydroxyphenyl)methyl carbonate (PubChem CID 87837338) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is butyl (3,5-ditert-butyl-4-hydroxyphenyl)methyl carbonate.

Molecular Properties

Compound Namebutyl (3,5-ditert-butyl-4-hydroxyphenyl)methyl carbonate
PubChem CID87837338
Molecular FormulaC20H32O4
Molecular Weight336.47 g/mol
Exact Mass336.23
IUPAC Namebutyl (3,5-ditert-butyl-4-hydroxyphenyl)methyl carbonate
SMILESCCCCOC(=O)OCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1
InChIInChI=1S/C20H32O4/c1-8-9-10-23-18(22)24-13-14-11-15(19(2,3)4)17(21)16(12-14)20(5,6)7/h11-12,21H,8-10,13H2,1-7H3
InChIKeyOEELBCPYIKKION-UHFFFAOYSA-N
XLogP5.44
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500336.47
LogP ≤ 55.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze butyl (3,5-ditert-butyl-4-hydroxyphenyl)methyl carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butyl (3,5-ditert-butyl-4-hydroxyphenyl)methyl carbonate?
The IUPAC name of butyl (3,5-ditert-butyl-4-hydroxyphenyl)methyl carbonate (CID 87837338) is butyl (3,5-ditert-butyl-4-hydroxyphenyl)methyl carbonate.
What is the SMILES notation for butyl (3,5-ditert-butyl-4-hydroxyphenyl)methyl carbonate?
The canonical SMILES for butyl (3,5-ditert-butyl-4-hydroxyphenyl)methyl carbonate is CCCCOC(=O)OCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.
What is the InChIKey of butyl (3,5-ditert-butyl-4-hydroxyphenyl)methyl carbonate?
The InChIKey is OEELBCPYIKKION-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32O4/c1-8-9-10-23-18(22)24-13-14-11-15(19(2,3)4)17(21)16(12-14)20(5,6)7/h11-12,21H,8-10,13H2,1-7H3.
What are the key properties of butyl (3,5-ditert-butyl-4-hydroxyphenyl)methyl carbonate?
butyl (3,5-ditert-butyl-4-hydroxyphenyl)methyl carbonate has a molecular weight of 336.47 g/mol, XLogP of 5.44, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl (3,5-ditert-butyl-4-hydroxyphenyl)methyl carbonate is sourced from PubChem (CID 87837338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).