C38H60N2O6 — CID 100920458
(3,5-ditert-butyl-4-hydroxyphenyl)methyl N-[6-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxycarbonylamino]hexyl]carbamate (PubChem CID 100920458) has the molecular formula C38H60N2O6 and a molecular weight of 640.91 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxyphenyl)methyl N-[6-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxycarbonylamino]hexyl]carbamate.
| Compound Name | (3,5-ditert-butyl-4-hydroxyphenyl)methyl N-[6-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxycarbonylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 100920458 |
| Molecular Formula | C38H60N2O6 |
| Molecular Weight | 640.91 g/mol |
| Exact Mass | 640.45 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxyphenyl)methyl N-[6-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxycarbonylamino]hexyl]carbamate |
| SMILES | CC(C)(C)c1cc(COC(=O)NCCCCCCNC(=O)OCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C38H60N2O6/c1-35(2,3)27-19-25(20-28(31(27)41)36(4,5)6)23-45-33(43)39-17-15-13-14-16-18-40-34(44)46-24-26-21-29(37(7,8)9)32(42)30(22-26)38(10,11)12/h19-22,41-42H,13-18,23-24H2,1-12H3,(H,39,43)(H,40,44) |
| InChIKey | PHSVWLDDGMEFFF-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.91 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|