C23H39NO2 — CID 19991674
3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-hexylpropanamide (PubChem CID 19991674) has the molecular formula C23H39NO2 and a molecular weight of 361.57 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-hexylpropanamide.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-hexylpropanamide |
|---|---|
| PubChem CID | 19991674 |
| Molecular Formula | C23H39NO2 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.30 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-hexylpropanamide |
| SMILES | CCCCCCNC(=O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H39NO2/c1-8-9-10-11-14-24-20(25)13-12-17-15-18(22(2,3)4)21(26)19(16-17)23(5,6)7/h15-16,26H,8-14H2,1-7H3,(H,24,25) |
| InChIKey | SYMPSRSAQXTTBU-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|