C22H37NO2 — CID 14988663
N-(3,5-ditert-butyl-4-hydroxyphenyl)octanamide (PubChem CID 14988663) has the molecular formula C22H37NO2 and a molecular weight of 347.54 g/mol. Its IUPAC name is N-(3,5-ditert-butyl-4-hydroxyphenyl)octanamide.
| Compound Name | N-(3,5-ditert-butyl-4-hydroxyphenyl)octanamide |
|---|---|
| PubChem CID | 14988663 |
| Molecular Formula | C22H37NO2 |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | N-(3,5-ditert-butyl-4-hydroxyphenyl)octanamide |
| SMILES | CCCCCCCC(=O)Nc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H37NO2/c1-8-9-10-11-12-13-19(24)23-16-14-17(21(2,3)4)20(25)18(15-16)22(5,6)7/h14-15,25H,8-13H2,1-7H3,(H,23,24) |
| InChIKey | BVBFUFRNUCYGBH-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|