C25H43NO3 — CID 21446651
N-(3,5-ditert-butyl-4-hydroxyphenyl)-3-(2-ethylhexoxy)propanamide (PubChem CID 21446651) has the molecular formula C25H43NO3 and a molecular weight of 405.62 g/mol. Its IUPAC name is N-(3,5-ditert-butyl-4-hydroxyphenyl)-3-(2-ethylhexoxy)propanamide.
| Compound Name | N-(3,5-ditert-butyl-4-hydroxyphenyl)-3-(2-ethylhexoxy)propanamide |
|---|---|
| PubChem CID | 21446651 |
| Molecular Formula | C25H43NO3 |
| Molecular Weight | 405.62 g/mol |
| Exact Mass | 405.32 |
| IUPAC Name | N-(3,5-ditert-butyl-4-hydroxyphenyl)-3-(2-ethylhexoxy)propanamide |
| SMILES | CCCCC(CC)COCCC(=O)Nc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H43NO3/c1-9-11-12-18(10-2)17-29-14-13-22(27)26-19-15-20(24(3,4)5)23(28)21(16-19)25(6,7)8/h15-16,18,28H,9-14,17H2,1-8H3,(H,26,27) |
| InChIKey | OJEKXWKYEWOGBU-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|