C20H30N2O2 — CID 15170949
5-cyano-N-(3,5-ditert-butyl-4-hydroxyphenyl)pentanamide (PubChem CID 15170949) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 5-cyano-N-(3,5-ditert-butyl-4-hydroxyphenyl)pentanamide.
| Compound Name | 5-cyano-N-(3,5-ditert-butyl-4-hydroxyphenyl)pentanamide |
|---|---|
| PubChem CID | 15170949 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 5-cyano-N-(3,5-ditert-butyl-4-hydroxyphenyl)pentanamide |
| SMILES | CC(C)(C)c1cc(NC(=O)CCCCC#N)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C20H30N2O2/c1-19(2,3)15-12-14(13-16(18(15)24)20(4,5)6)22-17(23)10-8-7-9-11-21/h12-13,24H,7-10H2,1-6H3,(H,22,23) |
| InChIKey | JHIHCIGHBXZKKO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|