C18H27NO2 — CID 15027734
4-(3,5-ditert-butyl-4-hydroxyphenoxy)butanenitrile (PubChem CID 15027734) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 4-(3,5-ditert-butyl-4-hydroxyphenoxy)butanenitrile.
| Compound Name | 4-(3,5-ditert-butyl-4-hydroxyphenoxy)butanenitrile |
|---|---|
| PubChem CID | 15027734 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 4-(3,5-ditert-butyl-4-hydroxyphenoxy)butanenitrile |
| SMILES | CC(C)(C)c1cc(OCCCC#N)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C18H27NO2/c1-17(2,3)14-11-13(21-10-8-7-9-19)12-15(16(14)20)18(4,5)6/h11-12,20H,7-8,10H2,1-6H3 |
| InChIKey | KAAFVINNQWYCNH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|