C18H32O2 — CID 143041042
2,6-ditert-butyl-4-ethoxyphenol;ethane (PubChem CID 143041042) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-ethoxyphenol;ethane.
| Compound Name | 2,6-ditert-butyl-4-ethoxyphenol;ethane |
|---|---|
| PubChem CID | 143041042 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 2,6-ditert-butyl-4-ethoxyphenol;ethane |
| SMILES | CC.CCOc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C16H26O2.C2H6/c1-8-18-11-9-12(15(2,3)4)14(17)13(10-11)16(5,6)7;1-2/h9-10,17H,8H2,1-7H3;1-2H3 |
| InChIKey | FCZQAMZQDQBHRC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |