C28H36O2Si — CID 11475991
2,6-ditert-butyl-4-[[methyl(diphenyl)silyl]methoxy]phenol (PubChem CID 11475991) has the molecular formula C28H36O2Si and a molecular weight of 432.68 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[methyl(diphenyl)silyl]methoxy]phenol.
| Compound Name | 2,6-ditert-butyl-4-[[methyl(diphenyl)silyl]methoxy]phenol |
|---|---|
| PubChem CID | 11475991 |
| Molecular Formula | C28H36O2Si |
| Molecular Weight | 432.68 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 2,6-ditert-butyl-4-[[methyl(diphenyl)silyl]methoxy]phenol |
| SMILES | CC(C)(C)c1cc(OC[Si](C)(c2ccccc2)c2ccccc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C28H36O2Si/c1-27(2,3)24-18-21(19-25(26(24)29)28(4,5)6)30-20-31(7,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-19,29H,20H2,1-7H3 |
| InChIKey | BDTJAVAZVIQOOT-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.68 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|