C22H27NO2 — CID 15027732
3-[(3,5-ditert-butyl-4-hydroxyphenoxy)methyl]benzonitrile (PubChem CID 15027732) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is 3-[(3,5-ditert-butyl-4-hydroxyphenoxy)methyl]benzonitrile.
| Compound Name | 3-[(3,5-ditert-butyl-4-hydroxyphenoxy)methyl]benzonitrile |
|---|---|
| PubChem CID | 15027732 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 3-[(3,5-ditert-butyl-4-hydroxyphenoxy)methyl]benzonitrile |
| SMILES | CC(C)(C)c1cc(OCc2cccc(C#N)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H27NO2/c1-21(2,3)18-11-17(12-19(20(18)24)22(4,5)6)25-14-16-9-7-8-15(10-16)13-23/h7-12,24H,14H2,1-6H3 |
| InChIKey | RBODKYFNKGYKHX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |