C28H44O4Si — CID 91539613
2,6-ditert-butyl-4-[[[4-[2-(2-methoxyethoxy)ethyl]phenyl]-dimethylsilyl]methoxy]phenol (PubChem CID 91539613) has the molecular formula C28H44O4Si and a molecular weight of 472.74 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[[4-[2-(2-methoxyethoxy)ethyl]phenyl]-dimethylsilyl]methoxy]phenol.
| Compound Name | 2,6-ditert-butyl-4-[[[4-[2-(2-methoxyethoxy)ethyl]phenyl]-dimethylsilyl]methoxy]phenol |
|---|---|
| PubChem CID | 91539613 |
| Molecular Formula | C28H44O4Si |
| Molecular Weight | 472.74 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | 2,6-ditert-butyl-4-[[[4-[2-(2-methoxyethoxy)ethyl]phenyl]-dimethylsilyl]methoxy]phenol |
| SMILES | COCCOCCc1ccc([Si](C)(C)COc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C28H44O4Si/c1-27(2,3)24-18-22(19-25(26(24)29)28(4,5)6)32-20-33(8,9)23-12-10-21(11-13-23)14-15-31-17-16-30-7/h10-13,18-19,29H,14-17,20H2,1-9H3 |
| InChIKey | SAORETPJCUCPJK-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.74 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|