About [2,6-ditert-butyl-4-[[dimethyl-[4-(trifluoromethyl)phenyl]silyl]methoxy]phenyl] acetate
[2,6-ditert-butyl-4-[[dimethyl-[4-(trifluoromethyl)phenyl]silyl]methoxy]phenyl] acetate (PubChem CID 67706895) has the molecular formula C26H35F3O3Si
and a molecular weight of 480.64 g/mol. Its IUPAC name is [2,6-ditert-butyl-4-[[dimethyl-[4-(trifluoromethyl)phenyl]silyl]methoxy]phenyl] acetate.
Molecular Properties
| Compound Name | [2,6-ditert-butyl-4-[[dimethyl-[4-(trifluoromethyl)phenyl]silyl]methoxy]phenyl] acetate |
| PubChem CID | 67706895 |
| Molecular Formula | C26H35F3O3Si |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | [2,6-ditert-butyl-4-[[dimethyl-[4-(trifluoromethyl)phenyl]silyl]methoxy]phenyl] acetate |
| SMILES | CC(=O)Oc1c(C(C)(C)C)cc(OC[Si](C)(C)c2ccc(C(F)(F)F)cc2)cc1C(C)(C)C |
| InChI | InChI=1S/C26H35F3O3Si/c1-17(30)32-23-21(24(2,3)4)14-19(15-22(23)25(5,6)7)31-16-33(8,9)20-12-10-18(11-13-20)26(27,28)29/h10-15H,16H2,1-9H3 |
| InChIKey | HHBLXYWODRXHGP-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2,6-ditert-butyl-4-[[dimethyl-[4-(trifluoromethyl)phenyl]silyl]methoxy]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-ditert-butyl-4-[[dimethyl-[4-(trifluoromethyl)phenyl]silyl]methoxy]phenyl] acetate?
The IUPAC name of [2,6-ditert-butyl-4-[[dimethyl-[4-(trifluoromethyl)phenyl]silyl]methoxy]phenyl] acetate (CID 67706895) is [2,6-ditert-butyl-4-[[dimethyl-[4-(trifluoromethyl)phenyl]silyl]methoxy]phenyl] acetate.
What is the SMILES notation for [2,6-ditert-butyl-4-[[dimethyl-[4-(trifluoromethyl)phenyl]silyl]methoxy]phenyl] acetate?
The canonical SMILES for [2,6-ditert-butyl-4-[[dimethyl-[4-(trifluoromethyl)phenyl]silyl]methoxy]phenyl] acetate is CC(=O)Oc1c(C(C)(C)C)cc(OC[Si](C)(C)c2ccc(C(F)(F)F)cc2)cc1C(C)(C)C.
What is the InChIKey of [2,6-ditert-butyl-4-[[dimethyl-[4-(trifluoromethyl)phenyl]silyl]methoxy]phenyl] acetate?
The InChIKey is HHBLXYWODRXHGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H35F3O3Si/c1-17(30)32-23-21(24(2,3)4)14-19(15-22(23)25(5,6)7)31-16-33(8,9)20-12-10-18(11-13-20)26(27,28)29/h10-15H,16H2,1-9H3.
What are the key properties of [2,6-ditert-butyl-4-[[dimethyl-[4-(trifluoromethyl)phenyl]silyl]methoxy]phenyl] acetate?
[2,6-ditert-butyl-4-[[dimethyl-[4-(trifluoromethyl)phenyl]silyl]methoxy]phenyl] acetate has a molecular weight of 480.64 g/mol, XLogP of 6.76, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-ditert-butyl-4-[[dimethyl-[4-(trifluoromethyl)phenyl]silyl]methoxy]phenyl] acetate is sourced from PubChem (CID 67706895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).