C35H40BrO2P — CID 139910842
[4-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-2,6-ditert-butylphenyl] acetate (PubChem CID 139910842) has the molecular formula C35H40BrO2P and a molecular weight of 603.58 g/mol. Its IUPAC name is [4-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-2,6-ditert-butylphenyl] acetate.
| Compound Name | [4-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-2,6-ditert-butylphenyl] acetate |
|---|---|
| PubChem CID | 139910842 |
| Molecular Formula | C35H40BrO2P |
| Molecular Weight | 603.58 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | [4-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-2,6-ditert-butylphenyl] acetate |
| SMILES | CC(=O)Oc1c(C(C)(C)C)cc(CP(Br)(c2ccccc2)(c2ccccc2)c2ccccc2)cc1C(C)(C)C |
| InChI | InChI=1S/C35H40BrO2P/c1-26(37)38-33-31(34(2,3)4)23-27(24-32(33)35(5,6)7)25-39(36,28-17-11-8-12-18-28,29-19-13-9-14-20-29)30-21-15-10-16-22-30/h8-24H,25H2,1-7H3 |
| InChIKey | HZBXYFXYRSHVHQ-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.58 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|