C20H26O2S — CID 102013088
(2,6-ditert-butyl-4-thiophen-3-ylphenyl) acetate (PubChem CID 102013088) has the molecular formula C20H26O2S and a molecular weight of 330.49 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-thiophen-3-ylphenyl) acetate.
| Compound Name | (2,6-ditert-butyl-4-thiophen-3-ylphenyl) acetate |
|---|---|
| PubChem CID | 102013088 |
| Molecular Formula | C20H26O2S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (2,6-ditert-butyl-4-thiophen-3-ylphenyl) acetate |
| SMILES | CC(=O)Oc1c(C(C)(C)C)cc(-c2ccsc2)cc1C(C)(C)C |
| InChI | InChI=1S/C20H26O2S/c1-13(21)22-18-16(19(2,3)4)10-15(14-8-9-23-12-14)11-17(18)20(5,6)7/h8-12H,1-7H3 |
| InChIKey | RYLSCZRYVAMNPU-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|