C51H59BrO5 — CID 122227163
[4-[6-(4-acetyloxy-3,5-ditert-butylphenyl)-9-bromo-10-(3-hydroxy-3-methylbut-1-ynyl)anthracen-2-yl]-2,6-ditert-butylphenyl] acetate (PubChem CID 122227163) has the molecular formula C51H59BrO5 and a molecular weight of 831.93 g/mol. Its IUPAC name is [4-[6-(4-acetyloxy-3,5-ditert-butylphenyl)-9-bromo-10-(3-hydroxy-3-methylbut-1-ynyl)anthracen-2-yl]-2,6-ditert-butylphenyl] acetate.
| Compound Name | [4-[6-(4-acetyloxy-3,5-ditert-butylphenyl)-9-bromo-10-(3-hydroxy-3-methylbut-1-ynyl)anthracen-2-yl]-2,6-ditert-butylphenyl] acetate |
|---|---|
| PubChem CID | 122227163 |
| Molecular Formula | C51H59BrO5 |
| Molecular Weight | 831.93 g/mol |
| Exact Mass | 830.35 |
| IUPAC Name | [4-[6-(4-acetyloxy-3,5-ditert-butylphenyl)-9-bromo-10-(3-hydroxy-3-methylbut-1-ynyl)anthracen-2-yl]-2,6-ditert-butylphenyl] acetate |
| SMILES | CC(=O)Oc1c(C(C)(C)C)cc(-c2ccc3c(C#CC(C)(C)O)c4cc(-c5cc(C(C)(C)C)c(OC(C)=O)c(C(C)(C)C)c5)ccc4c(Br)c3c2)cc1C(C)(C)C |
| InChI | InChI=1S/C51H59BrO5/c1-29(53)56-45-40(47(3,4)5)25-33(26-41(45)48(6,7)8)31-18-20-37-38(23-31)36(21-22-51(15,16)55)35-19-17-32(24-39(35)44(37)52)34-27-42(49(9,10)11)46(57-30(2)54)43(28-34)50(12,13)14/h17-20,23-28,55H,1-16H3 |
| InChIKey | PABCBFKVIHYUNM-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.93 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|