C46H52Br2O4 — CID 177478950
[4-[7-(4-acetyloxy-3,5-ditert-butylphenyl)-9,10-dibromoanthracen-2-yl]-2,6-ditert-butylphenyl] acetate (PubChem CID 177478950) has the molecular formula C46H52Br2O4 and a molecular weight of 828.73 g/mol. Its IUPAC name is [4-[7-(4-acetyloxy-3,5-ditert-butylphenyl)-9,10-dibromoanthracen-2-yl]-2,6-ditert-butylphenyl] acetate.
| Compound Name | [4-[7-(4-acetyloxy-3,5-ditert-butylphenyl)-9,10-dibromoanthracen-2-yl]-2,6-ditert-butylphenyl] acetate |
|---|---|
| PubChem CID | 177478950 |
| Molecular Formula | C46H52Br2O4 |
| Molecular Weight | 828.73 g/mol |
| Exact Mass | 826.22 |
| IUPAC Name | [4-[7-(4-acetyloxy-3,5-ditert-butylphenyl)-9,10-dibromoanthracen-2-yl]-2,6-ditert-butylphenyl] acetate |
| SMILES | CC(=O)Oc1c(C(C)(C)C)cc(-c2ccc3c(Br)c4ccc(-c5cc(C(C)(C)C)c(OC(C)=O)c(C(C)(C)C)c5)cc4c(Br)c3c2)cc1C(C)(C)C |
| InChI | InChI=1S/C46H52Br2O4/c1-25(49)51-41-35(43(3,4)5)21-29(22-36(41)44(6,7)8)27-15-17-31-33(19-27)40(48)34-20-28(16-18-32(34)39(31)47)30-23-37(45(9,10)11)42(52-26(2)50)38(24-30)46(12,13)14/h15-24H,1-14H3 |
| InChIKey | WLCLZQARSRFQRN-UHFFFAOYSA-N |
| XLogP | 13.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.73 |
| LogP ≤ 5 | 13.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|