C22H20O6 — CID 23038229
(4-acetyloxy-2,3-dimethoxy-6-phenylnaphthalen-1-yl) acetate (PubChem CID 23038229) has the molecular formula C22H20O6 and a molecular weight of 380.40 g/mol. Its IUPAC name is (4-acetyloxy-2,3-dimethoxy-6-phenylnaphthalen-1-yl) acetate.
| Compound Name | (4-acetyloxy-2,3-dimethoxy-6-phenylnaphthalen-1-yl) acetate |
|---|---|
| PubChem CID | 23038229 |
| Molecular Formula | C22H20O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (4-acetyloxy-2,3-dimethoxy-6-phenylnaphthalen-1-yl) acetate |
| SMILES | COc1c(OC)c(OC(C)=O)c2cc(-c3ccccc3)ccc2c1OC(C)=O |
| InChI | InChI=1S/C22H20O6/c1-13(23)27-19-17-11-10-16(15-8-6-5-7-9-15)12-18(17)20(28-14(2)24)22(26-4)21(19)25-3/h5-12H,1-4H3 |
| InChIKey | GPBBXHICOCAFGO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|