C19H22O7S — CID 23038446
(4-acetyloxy-2,3-dimethoxy-7-methylsulfinylnaphthalen-1-yl) butanoate (PubChem CID 23038446) has the molecular formula C19H22O7S and a molecular weight of 394.45 g/mol. Its IUPAC name is (4-acetyloxy-2,3-dimethoxy-7-methylsulfinylnaphthalen-1-yl) butanoate.
| Compound Name | (4-acetyloxy-2,3-dimethoxy-7-methylsulfinylnaphthalen-1-yl) butanoate |
|---|---|
| PubChem CID | 23038446 |
| Molecular Formula | C19H22O7S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | (4-acetyloxy-2,3-dimethoxy-7-methylsulfinylnaphthalen-1-yl) butanoate |
| SMILES | CCCC(=O)Oc1c(OC)c(OC)c(OC(C)=O)c2ccc(S(C)=O)cc12 |
| InChI | InChI=1S/C19H22O7S/c1-6-7-15(21)26-17-14-10-12(27(5)22)8-9-13(14)16(25-11(2)20)18(23-3)19(17)24-4/h8-10H,6-7H2,1-5H3 |
| InChIKey | SAYBAXAEPCNRAL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|