C19H21ClO6 — CID 149158601
(6-chloro-2,3-dimethoxy-4-propanoyloxynaphthalen-1-yl) butanoate (PubChem CID 149158601) has the molecular formula C19H21ClO6 and a molecular weight of 380.82 g/mol. Its IUPAC name is (6-chloro-2,3-dimethoxy-4-propanoyloxynaphthalen-1-yl) butanoate.
| Compound Name | (6-chloro-2,3-dimethoxy-4-propanoyloxynaphthalen-1-yl) butanoate |
|---|---|
| PubChem CID | 149158601 |
| Molecular Formula | C19H21ClO6 |
| Molecular Weight | 380.82 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | (6-chloro-2,3-dimethoxy-4-propanoyloxynaphthalen-1-yl) butanoate |
| SMILES | CCCC(=O)Oc1c(OC)c(OC)c(OC(=O)CC)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C19H21ClO6/c1-5-7-15(22)26-16-12-9-8-11(20)10-13(12)17(25-14(21)6-2)19(24-4)18(16)23-3/h8-10H,5-7H2,1-4H3 |
| InChIKey | QNZLFUKTKNOHCE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.82 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|