C28H39ClO8 — CID 19886723
[6-chloro-2,3-dimethoxy-4-(2-methylhexoxycarbonyloxy)naphthalen-1-yl] 2-methylhexyl carbonate (PubChem CID 19886723) has the molecular formula C28H39ClO8 and a molecular weight of 539.07 g/mol. Its IUPAC name is [6-chloro-2,3-dimethoxy-4-(2-methylhexoxycarbonyloxy)naphthalen-1-yl] 2-methylhexyl carbonate.
| Compound Name | [6-chloro-2,3-dimethoxy-4-(2-methylhexoxycarbonyloxy)naphthalen-1-yl] 2-methylhexyl carbonate |
|---|---|
| PubChem CID | 19886723 |
| Molecular Formula | C28H39ClO8 |
| Molecular Weight | 539.07 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | [6-chloro-2,3-dimethoxy-4-(2-methylhexoxycarbonyloxy)naphthalen-1-yl] 2-methylhexyl carbonate |
| SMILES | CCCCC(C)COC(=O)Oc1c(OC)c(OC)c(OC(=O)OCC(C)CCCC)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C28H39ClO8/c1-7-9-11-18(3)16-34-27(30)36-23-21-14-13-20(29)15-22(21)24(26(33-6)25(23)32-5)37-28(31)35-17-19(4)12-10-8-2/h13-15,18-19H,7-12,16-17H2,1-6H3 |
| InChIKey | HRSGOTFLXJSJGP-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.07 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|