C36H50O6 — CID 135239718
[2,7-diethyl-10-(2-ethylhexoxycarbonyloxy)anthracen-9-yl] 2-ethylhexyl carbonate (PubChem CID 135239718) has the molecular formula C36H50O6 and a molecular weight of 578.79 g/mol. Its IUPAC name is [2,7-diethyl-10-(2-ethylhexoxycarbonyloxy)anthracen-9-yl] 2-ethylhexyl carbonate.
| Compound Name | [2,7-diethyl-10-(2-ethylhexoxycarbonyloxy)anthracen-9-yl] 2-ethylhexyl carbonate |
|---|---|
| PubChem CID | 135239718 |
| Molecular Formula | C36H50O6 |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.36 |
| IUPAC Name | [2,7-diethyl-10-(2-ethylhexoxycarbonyloxy)anthracen-9-yl] 2-ethylhexyl carbonate |
| SMILES | CCCCC(CC)COC(=O)Oc1c2ccc(CC)cc2c(OC(=O)OCC(CC)CCCC)c2cc(CC)ccc12 |
| InChI | InChI=1S/C36H50O6/c1-7-13-15-27(11-5)23-39-35(37)41-33-29-19-17-25(9-3)21-31(29)34(32-22-26(10-4)18-20-30(32)33)42-36(38)40-24-28(12-6)16-14-8-2/h17-22,27-28H,7-16,23-24H2,1-6H3 |
| InChIKey | OMZDOZHLIWWMKA-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|