C28H34O6 — CID 135239666
(10-butoxycarbonyloxy-2,6-diethylanthracen-9-yl) butyl carbonate (PubChem CID 135239666) has the molecular formula C28H34O6 and a molecular weight of 466.57 g/mol. Its IUPAC name is (10-butoxycarbonyloxy-2,6-diethylanthracen-9-yl) butyl carbonate.
| Compound Name | (10-butoxycarbonyloxy-2,6-diethylanthracen-9-yl) butyl carbonate |
|---|---|
| PubChem CID | 135239666 |
| Molecular Formula | C28H34O6 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | (10-butoxycarbonyloxy-2,6-diethylanthracen-9-yl) butyl carbonate |
| SMILES | CCCCOC(=O)Oc1c2ccc(CC)cc2c(OC(=O)OCCCC)c2ccc(CC)cc12 |
| InChI | InChI=1S/C28H34O6/c1-5-9-15-31-27(29)33-25-21-13-11-20(8-4)18-24(21)26(34-28(30)32-16-10-6-2)22-14-12-19(7-3)17-23(22)25/h11-14,17-18H,5-10,15-16H2,1-4H3 |
| InChIKey | DZIIIOIUDDUCEM-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|