C32H42O6 — CID 135239670
(1,5-diethyl-10-hexoxycarbonyloxyanthracen-9-yl) hexyl carbonate (PubChem CID 135239670) has the molecular formula C32H42O6 and a molecular weight of 522.68 g/mol. Its IUPAC name is (1,5-diethyl-10-hexoxycarbonyloxyanthracen-9-yl) hexyl carbonate.
| Compound Name | (1,5-diethyl-10-hexoxycarbonyloxyanthracen-9-yl) hexyl carbonate |
|---|---|
| PubChem CID | 135239670 |
| Molecular Formula | C32H42O6 |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | (1,5-diethyl-10-hexoxycarbonyloxyanthracen-9-yl) hexyl carbonate |
| SMILES | CCCCCCOC(=O)Oc1c2cccc(CC)c2c(OC(=O)OCCCCCC)c2cccc(CC)c12 |
| InChI | InChI=1S/C32H42O6/c1-5-9-11-13-21-35-31(33)37-29-25-19-15-18-24(8-4)28(25)30(26-20-16-17-23(7-3)27(26)29)38-32(34)36-22-14-12-10-6-2/h15-20H,5-14,21-22H2,1-4H3 |
| InChIKey | LHLAEYRGCAQNQI-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|