About hexyl (2-propylphenyl) carbonate
hexyl (2-propylphenyl) carbonate (PubChem CID 67179757) has the molecular formula C16H24O3
and a molecular weight of 264.36 g/mol. Its IUPAC name is hexyl (2-propylphenyl) carbonate.
Molecular Properties
| Compound Name | hexyl (2-propylphenyl) carbonate |
| PubChem CID | 67179757 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | hexyl (2-propylphenyl) carbonate |
| SMILES | CCCCCCOC(=O)Oc1ccccc1CCC |
| InChI | InChI=1S/C16H24O3/c1-3-5-6-9-13-18-16(17)19-15-12-8-7-11-14(15)10-4-2/h7-8,11-12H,3-6,9-10,13H2,1-2H3 |
| InChIKey | AYJGNGLXDIYYKO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze hexyl (2-propylphenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl (2-propylphenyl) carbonate?
The IUPAC name of hexyl (2-propylphenyl) carbonate (CID 67179757) is hexyl (2-propylphenyl) carbonate.
What is the SMILES notation for hexyl (2-propylphenyl) carbonate?
The canonical SMILES for hexyl (2-propylphenyl) carbonate is CCCCCCOC(=O)Oc1ccccc1CCC.
What is the InChIKey of hexyl (2-propylphenyl) carbonate?
The InChIKey is AYJGNGLXDIYYKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O3/c1-3-5-6-9-13-18-16(17)19-15-12-8-7-11-14(15)10-4-2/h7-8,11-12H,3-6,9-10,13H2,1-2H3.
What are the key properties of hexyl (2-propylphenyl) carbonate?
hexyl (2-propylphenyl) carbonate has a molecular weight of 264.36 g/mol, XLogP of 4.73, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl (2-propylphenyl) carbonate is sourced from PubChem (CID 67179757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).