About 4-phenylbutyl (2-propylphenyl) carbonate
4-phenylbutyl (2-propylphenyl) carbonate (PubChem CID 67258124) has the molecular formula C20H24O3
and a molecular weight of 312.41 g/mol. Its IUPAC name is 4-phenylbutyl (2-propylphenyl) carbonate.
Molecular Properties
| Compound Name | 4-phenylbutyl (2-propylphenyl) carbonate |
| PubChem CID | 67258124 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 4-phenylbutyl (2-propylphenyl) carbonate |
| SMILES | CCCc1ccccc1OC(=O)OCCCCc1ccccc1 |
| InChI | InChI=1S/C20H24O3/c1-2-10-18-14-6-7-15-19(18)23-20(21)22-16-9-8-13-17-11-4-3-5-12-17/h3-7,11-12,14-15H,2,8-10,13,16H2,1H3 |
| InChIKey | VFJMLIWEGCLMKT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylbutyl (2-propylphenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylbutyl (2-propylphenyl) carbonate?
The IUPAC name of 4-phenylbutyl (2-propylphenyl) carbonate (CID 67258124) is 4-phenylbutyl (2-propylphenyl) carbonate.
What is the SMILES notation for 4-phenylbutyl (2-propylphenyl) carbonate?
The canonical SMILES for 4-phenylbutyl (2-propylphenyl) carbonate is CCCc1ccccc1OC(=O)OCCCCc1ccccc1.
What is the InChIKey of 4-phenylbutyl (2-propylphenyl) carbonate?
The InChIKey is VFJMLIWEGCLMKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24O3/c1-2-10-18-14-6-7-15-19(18)23-20(21)22-16-9-8-13-17-11-4-3-5-12-17/h3-7,11-12,14-15H,2,8-10,13,16H2,1H3.
What are the key properties of 4-phenylbutyl (2-propylphenyl) carbonate?
4-phenylbutyl (2-propylphenyl) carbonate has a molecular weight of 312.41 g/mol, XLogP of 5.18, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylbutyl (2-propylphenyl) carbonate is sourced from PubChem (CID 67258124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).